C21H25FO5 — CID 171035317
(1S,2S,14R,15S)-8-fluoro-14-hydroxy-14-(2-hydroxyacetyl)-2,15-dimethyl-18-oxapentacyclo[8.8.0.01,17.02,7.011,15]octadeca-3,6-dien-5-one (PubChem CID 171035317) has the molecular formula C21H25FO5 and a molecular weight of 376.42 g/mol. Its IUPAC name is (1S,2S,14R,15S)-8-fluoro-14-hydroxy-14-(2-hydroxyacetyl)-2,15-dimethyl-18-oxapentacyclo[8.8.0.01,17.02,7.011,15]octadeca-3,6-dien-5-one.
| Compound Name | (1S,2S,14R,15S)-8-fluoro-14-hydroxy-14-(2-hydroxyacetyl)-2,15-dimethyl-18-oxapentacyclo[8.8.0.01,17.02,7.011,15]octadeca-3,6-dien-5-one |
|---|---|
| PubChem CID | 171035317 |
| Molecular Formula | C21H25FO5 |
| Molecular Weight | 376.42 g/mol |
| Exact Mass | 376.17 |
| IUPAC Name | (1S,2S,14R,15S)-8-fluoro-14-hydroxy-14-(2-hydroxyacetyl)-2,15-dimethyl-18-oxapentacyclo[8.8.0.01,17.02,7.011,15]octadeca-3,6-dien-5-one |
| SMILES | C[C@]12C=CC(=O)C=C1C(F)CC1C3CC[C@](O)(C(=O)CO)[C@@]3(C)CC3O[C@@]312 |
| InChI | InChI=1S/C21H25FO5/c1-18-5-3-11(24)7-14(18)15(22)8-13-12-4-6-20(26,16(25)10-23)19(12,2)9-17-21(13,18)27-17/h3,5,7,12-13,15,17,23,26H,4,6,8-10H2,1-2H3/t12?,13?,15?,17?,18-,19-,20-,21+/m0/s1 |
| InChIKey | ODCJBFLIAVNDAG-DORMYCMZSA-N |
| XLogP | 1.67 |
| TPSA | 87.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.42 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|