C25H30ClFO5 — CID 57261706
[(1S,2S,8S,10S,11S,14R,15S,17S)-14-(2-chloroacetyl)-8-fluoro-2,15-dimethyl-5-oxo-18-oxapentacyclo[8.8.0.01,17.02,7.011,15]octadeca-3,6-dien-14-yl] butanoate (PubChem CID 57261706) has the molecular formula C25H30ClFO5 and a molecular weight of 464.96 g/mol. Its IUPAC name is [(1S,2S,8S,10S,11S,14R,15S,17S)-14-(2-chloroacetyl)-8-fluoro-2,15-dimethyl-5-oxo-18-oxapentacyclo[8.8.0.01,17.02,7.011,15]octadeca-3,6-dien-14-yl] butanoate.
| Compound Name | [(1S,2S,8S,10S,11S,14R,15S,17S)-14-(2-chloroacetyl)-8-fluoro-2,15-dimethyl-5-oxo-18-oxapentacyclo[8.8.0.01,17.02,7.011,15]octadeca-3,6-dien-14-yl] butanoate |
|---|---|
| PubChem CID | 57261706 |
| Molecular Formula | C25H30ClFO5 |
| Molecular Weight | 464.96 g/mol |
| Exact Mass | 464.18 |
| IUPAC Name | [(1S,2S,8S,10S,11S,14R,15S,17S)-14-(2-chloroacetyl)-8-fluoro-2,15-dimethyl-5-oxo-18-oxapentacyclo[8.8.0.01,17.02,7.011,15]octadeca-3,6-dien-14-yl] butanoate |
| SMILES | CCCC(=O)O[C@]1(C(=O)CCl)CC[C@H]2[C@@H]3C[C@H](F)C4=CC(=O)C=C[C@]4(C)[C@@]34O[C@H]4C[C@@]21C |
| InChI | InChI=1S/C25H30ClFO5/c1-4-5-21(30)32-24(19(29)13-26)9-7-15-16-11-18(27)17-10-14(28)6-8-22(17,2)25(16)20(31-25)12-23(15,24)3/h6,8,10,15-16,18,20H,4-5,7,9,11-13H2,1-3H3/t15-,16-,18-,20-,22-,23-,24-,25+/m0/s1 |
| InChIKey | BSAJZXMIOHPRSW-MHGHAZTCSA-N |
| XLogP | 4.26 |
| TPSA | 72.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.96 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|