C27H32F2O7 — CID 134311485
[(6S,8S,9R,10S,13S,14S,17R)-17-(2-acetyloxyacetyl)-6,9-difluoro-10,13-dimethyl-3,11-dioxo-7,8,12,14,15,16-hexahydro-6H-cyclopenta[a]phenanthren-17-yl] butanoate (PubChem CID 134311485) has the molecular formula C27H32F2O7 and a molecular weight of 506.54 g/mol. Its IUPAC name is [(6S,8S,9R,10S,13S,14S,17R)-17-(2-acetyloxyacetyl)-6,9-difluoro-10,13-dimethyl-3,11-dioxo-7,8,12,14,15,16-hexahydro-6H-cyclopenta[a]phenanthren-17-yl] butanoate.
| Compound Name | [(6S,8S,9R,10S,13S,14S,17R)-17-(2-acetyloxyacetyl)-6,9-difluoro-10,13-dimethyl-3,11-dioxo-7,8,12,14,15,16-hexahydro-6H-cyclopenta[a]phenanthren-17-yl] butanoate |
|---|---|
| PubChem CID | 134311485 |
| Molecular Formula | C27H32F2O7 |
| Molecular Weight | 506.54 g/mol |
| Exact Mass | 506.21 |
| IUPAC Name | [(6S,8S,9R,10S,13S,14S,17R)-17-(2-acetyloxyacetyl)-6,9-difluoro-10,13-dimethyl-3,11-dioxo-7,8,12,14,15,16-hexahydro-6H-cyclopenta[a]phenanthren-17-yl] butanoate |
| SMILES | CCCC(=O)O[C@]1(C(=O)COC(C)=O)CC[C@H]2[C@@H]3C[C@H](F)C4=CC(=O)C=C[C@]4(C)[C@@]3(F)C(=O)C[C@@]21C |
| InChI | InChI=1S/C27H32F2O7/c1-5-6-23(34)36-26(22(33)14-35-15(2)30)10-8-17-18-12-20(28)19-11-16(31)7-9-24(19,3)27(18,29)21(32)13-25(17,26)4/h7,9,11,17-18,20H,5-6,8,10,12-14H2,1-4H3/t17-,18-,20-,24-,25-,26-,27-/m0/s1 |
| InChIKey | DNPAQLBJCXMHCL-QVFWCVRWSA-N |
| XLogP | 3.73 |
| TPSA | 103.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.54 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |