C27H35ClO7 — CID 140563310
[(9R,10S,11S,13S,17R)-17-(2-acetyloxyacetyl)-9-chloro-11-hydroxy-10,13-dimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl] butanoate (PubChem CID 140563310) has the molecular formula C27H35ClO7 and a molecular weight of 507.02 g/mol. Its IUPAC name is [(9R,10S,11S,13S,17R)-17-(2-acetyloxyacetyl)-9-chloro-11-hydroxy-10,13-dimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl] butanoate.
| Compound Name | [(9R,10S,11S,13S,17R)-17-(2-acetyloxyacetyl)-9-chloro-11-hydroxy-10,13-dimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl] butanoate |
|---|---|
| PubChem CID | 140563310 |
| Molecular Formula | C27H35ClO7 |
| Molecular Weight | 507.02 g/mol |
| Exact Mass | 506.21 |
| IUPAC Name | [(9R,10S,11S,13S,17R)-17-(2-acetyloxyacetyl)-9-chloro-11-hydroxy-10,13-dimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl] butanoate |
| SMILES | CCCC(=O)O[C@]1(C(=O)COC(C)=O)CCC2C3CCC4=CC(=O)C=C[C@]4(C)[C@@]3(Cl)[C@@H](O)C[C@@]21C |
| InChI | InChI=1S/C27H35ClO7/c1-5-6-23(33)35-26(22(32)15-34-16(2)29)12-10-19-20-8-7-17-13-18(30)9-11-24(17,3)27(20,28)21(31)14-25(19,26)4/h9,11,13,19-21,31H,5-8,10,12,14-15H2,1-4H3/t19?,20?,21-,24-,25-,26-,27-/m0/s1 |
| InChIKey | CDQLPOWUINCOQM-RIVCZAQMSA-N |
| XLogP | 3.84 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.02 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|