C30H41ClO8 — CID 22813777
[2-[(8S,9R,10S,13S,14S,17R)-17-butoxycarbonyloxy-9-chloro-11-hydroxy-10,13-dimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] butanoate (PubChem CID 22813777) has the molecular formula C30H41ClO8 and a molecular weight of 565.10 g/mol. Its IUPAC name is [2-[(8S,9R,10S,13S,14S,17R)-17-butoxycarbonyloxy-9-chloro-11-hydroxy-10,13-dimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] butanoate.
| Compound Name | [2-[(8S,9R,10S,13S,14S,17R)-17-butoxycarbonyloxy-9-chloro-11-hydroxy-10,13-dimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] butanoate |
|---|---|
| PubChem CID | 22813777 |
| Molecular Formula | C30H41ClO8 |
| Molecular Weight | 565.10 g/mol |
| Exact Mass | 564.25 |
| IUPAC Name | [2-[(8S,9R,10S,13S,14S,17R)-17-butoxycarbonyloxy-9-chloro-11-hydroxy-10,13-dimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] butanoate |
| SMILES | CCCCOC(=O)O[C@]1(C(=O)COC(=O)CCC)CC[C@H]2[C@@H]3CCC4=CC(=O)C=C[C@]4(C)[C@@]3(Cl)C(O)C[C@@]21C |
| InChI | InChI=1S/C30H41ClO8/c1-5-7-15-37-26(36)39-29(24(34)18-38-25(35)8-6-2)14-12-21-22-10-9-19-16-20(32)11-13-27(19,3)30(22,31)23(33)17-28(21,29)4/h11,13,16,21-23,33H,5-10,12,14-15,17-18H2,1-4H3/t21-,22-,23?,27-,28-,29-,30-/m0/s1 |
| InChIKey | RZNFKQVVWPSXRC-PAZGNSOLSA-N |
| XLogP | 5.23 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.10 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|