C27H35ClO8 — CID 22813763
[2-[(8S,9R,10S,13S,14S,17R)-9-chloro-11-hydroxy-17-methoxycarbonyloxy-10,13-dimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] butanoate (PubChem CID 22813763) has the molecular formula C27H35ClO8 and a molecular weight of 523.02 g/mol. Its IUPAC name is [2-[(8S,9R,10S,13S,14S,17R)-9-chloro-11-hydroxy-17-methoxycarbonyloxy-10,13-dimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] butanoate.
| Compound Name | [2-[(8S,9R,10S,13S,14S,17R)-9-chloro-11-hydroxy-17-methoxycarbonyloxy-10,13-dimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] butanoate |
|---|---|
| PubChem CID | 22813763 |
| Molecular Formula | C27H35ClO8 |
| Molecular Weight | 523.02 g/mol |
| Exact Mass | 522.20 |
| IUPAC Name | [2-[(8S,9R,10S,13S,14S,17R)-9-chloro-11-hydroxy-17-methoxycarbonyloxy-10,13-dimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] butanoate |
| SMILES | CCCC(=O)OCC(=O)[C@@]1(OC(=O)OC)CC[C@H]2[C@@H]3CCC4=CC(=O)C=C[C@]4(C)[C@@]3(Cl)C(O)C[C@@]21C |
| InChI | InChI=1S/C27H35ClO8/c1-5-6-22(32)35-15-21(31)26(36-23(33)34-4)12-10-18-19-8-7-16-13-17(29)9-11-24(16,2)27(19,28)20(30)14-25(18,26)3/h9,11,13,18-20,30H,5-8,10,12,14-15H2,1-4H3/t18-,19-,20?,24-,25-,26-,27-/m0/s1 |
| InChIKey | OSWJGKPWLMNWKM-RHVMFJGASA-N |
| XLogP | 4.06 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.02 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|