C31H41ClO8 — CID 70585084
[2-[(8S,9R,10S,13S,14S,17R)-9-chloro-11-hydroxy-17-methoxycarbonyloxy-10,13-dimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] 3-cyclopentylpropanoate (PubChem CID 70585084) has the molecular formula C31H41ClO8 and a molecular weight of 577.11 g/mol. Its IUPAC name is [2-[(8S,9R,10S,13S,14S,17R)-9-chloro-11-hydroxy-17-methoxycarbonyloxy-10,13-dimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] 3-cyclopentylpropanoate.
| Compound Name | [2-[(8S,9R,10S,13S,14S,17R)-9-chloro-11-hydroxy-17-methoxycarbonyloxy-10,13-dimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] 3-cyclopentylpropanoate |
|---|---|
| PubChem CID | 70585084 |
| Molecular Formula | C31H41ClO8 |
| Molecular Weight | 577.11 g/mol |
| Exact Mass | 576.25 |
| IUPAC Name | [2-[(8S,9R,10S,13S,14S,17R)-9-chloro-11-hydroxy-17-methoxycarbonyloxy-10,13-dimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] 3-cyclopentylpropanoate |
| SMILES | COC(=O)O[C@]1(C(=O)COC(=O)CCC2CCCC2)CC[C@H]2[C@@H]3CCC4=CC(=O)C=C[C@]4(C)[C@@]3(Cl)C(O)C[C@@]21C |
| InChI | InChI=1S/C31H41ClO8/c1-28-14-12-21(33)16-20(28)9-10-23-22-13-15-30(40-27(37)38-3,29(22,2)17-24(34)31(23,28)32)25(35)18-39-26(36)11-8-19-6-4-5-7-19/h12,14,16,19,22-24,34H,4-11,13,15,17-18H2,1-3H3/t22-,23-,24?,28-,29-,30-,31-/m0/s1 |
| InChIKey | VJQQEONTFMGNKL-HUAVCJNQSA-N |
| XLogP | 5.23 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.11 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|