C26H33ClO7 — CID 70513981
[(8S,9R,10S,11S,13S,14S,17R)-17-(2-acetyloxyacetyl)-9-chloro-11-hydroxy-10,13-dimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl] propanoate (PubChem CID 70513981) has the molecular formula C26H33ClO7 and a molecular weight of 493.00 g/mol. Its IUPAC name is [(8S,9R,10S,11S,13S,14S,17R)-17-(2-acetyloxyacetyl)-9-chloro-11-hydroxy-10,13-dimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl] propanoate.
| Compound Name | [(8S,9R,10S,11S,13S,14S,17R)-17-(2-acetyloxyacetyl)-9-chloro-11-hydroxy-10,13-dimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl] propanoate |
|---|---|
| PubChem CID | 70513981 |
| Molecular Formula | C26H33ClO7 |
| Molecular Weight | 493.00 g/mol |
| Exact Mass | 492.19 |
| IUPAC Name | [(8S,9R,10S,11S,13S,14S,17R)-17-(2-acetyloxyacetyl)-9-chloro-11-hydroxy-10,13-dimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl] propanoate |
| SMILES | CCC(=O)O[C@]1(C(=O)COC(C)=O)CC[C@H]2[C@@H]3CCC4=CC(=O)C=C[C@]4(C)[C@@]3(Cl)[C@@H](O)C[C@@]21C |
| InChI | InChI=1S/C26H33ClO7/c1-5-22(32)34-25(21(31)14-33-15(2)28)11-9-18-19-7-6-16-12-17(29)8-10-23(16,3)26(19,27)20(30)13-24(18,25)4/h8,10,12,18-20,30H,5-7,9,11,13-14H2,1-4H3/t18-,19-,20-,23-,24-,25-,26-/m0/s1 |
| InChIKey | XEBVTNLWHGLMIQ-WMUQLZIPSA-N |
| XLogP | 3.45 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.00 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|