C27H34ClFO5 — CID 88714572
[(8S,9R,10S,13S,14S,17R)-17-(2-chloroacetyl)-9-fluoro-6,10,13-trimethyl-3,11-dioxo-7,8,12,14,15,16-hexahydro-6H-cyclopenta[a]phenanthren-17-yl] pentanoate (PubChem CID 88714572) has the molecular formula C27H34ClFO5 and a molecular weight of 493.02 g/mol. Its IUPAC name is [(8S,9R,10S,13S,14S,17R)-17-(2-chloroacetyl)-9-fluoro-6,10,13-trimethyl-3,11-dioxo-7,8,12,14,15,16-hexahydro-6H-cyclopenta[a]phenanthren-17-yl] pentanoate.
| Compound Name | [(8S,9R,10S,13S,14S,17R)-17-(2-chloroacetyl)-9-fluoro-6,10,13-trimethyl-3,11-dioxo-7,8,12,14,15,16-hexahydro-6H-cyclopenta[a]phenanthren-17-yl] pentanoate |
|---|---|
| PubChem CID | 88714572 |
| Molecular Formula | C27H34ClFO5 |
| Molecular Weight | 493.02 g/mol |
| Exact Mass | 492.21 |
| IUPAC Name | [(8S,9R,10S,13S,14S,17R)-17-(2-chloroacetyl)-9-fluoro-6,10,13-trimethyl-3,11-dioxo-7,8,12,14,15,16-hexahydro-6H-cyclopenta[a]phenanthren-17-yl] pentanoate |
| SMILES | CCCCC(=O)O[C@]1(C(=O)CCl)CC[C@H]2[C@@H]3CC(C)C4=CC(=O)C=C[C@]4(C)[C@@]3(F)C(=O)C[C@@]21C |
| InChI | InChI=1S/C27H34ClFO5/c1-5-6-7-23(33)34-26(22(32)15-28)11-9-18-20-12-16(2)19-13-17(30)8-10-24(19,3)27(20,29)21(31)14-25(18,26)4/h8,10,13,16,18,20H,5-7,9,11-12,14-15H2,1-4H3/t16?,18-,20-,24-,25-,26-,27-/m0/s1 |
| InChIKey | VUNLKAKKXIGCRP-YWQNLOPYSA-N |
| XLogP | 5.09 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.02 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|