C23H31FO4 — CID 90909396
9-fluoro-11,17-dihydroxy-6,10,13-trimethyl-17-propanoyl-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-3-one (PubChem CID 90909396) has the molecular formula C23H31FO4 and a molecular weight of 390.50 g/mol. Its IUPAC name is 9-fluoro-11,17-dihydroxy-6,10,13-trimethyl-17-propanoyl-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | 9-fluoro-11,17-dihydroxy-6,10,13-trimethyl-17-propanoyl-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 90909396 |
| Molecular Formula | C23H31FO4 |
| Molecular Weight | 390.50 g/mol |
| Exact Mass | 390.22 |
| IUPAC Name | 9-fluoro-11,17-dihydroxy-6,10,13-trimethyl-17-propanoyl-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-3-one |
| SMILES | CCC(=O)C1(O)CCC2C3CC(C)C4=CC(=O)C=CC4(C)C3(F)C(O)CC21C |
| InChI | InChI=1S/C23H31FO4/c1-5-18(26)22(28)9-7-15-17-10-13(2)16-11-14(25)6-8-20(16,3)23(17,24)19(27)12-21(15,22)4/h6,8,11,13,15,17,19,27-28H,5,7,9-10,12H2,1-4H3 |
| InChIKey | OQLYMKDQXUAABV-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.50 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |