C27H39FO5S — CID 142271922
S-[[(6S,9R,16R)-9-fluoro-11-hydroxy-17-methoxy-6,10,13,16-tetramethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl]methyl] propanethioate;formaldehyde (PubChem CID 142271922) has the molecular formula C27H39FO5S and a molecular weight of 494.67 g/mol. Its IUPAC name is S-[[(6S,9R,16R)-9-fluoro-11-hydroxy-17-methoxy-6,10,13,16-tetramethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl]methyl] propanethioate;formaldehyde.
| Compound Name | S-[[(6S,9R,16R)-9-fluoro-11-hydroxy-17-methoxy-6,10,13,16-tetramethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl]methyl] propanethioate;formaldehyde |
|---|---|
| PubChem CID | 142271922 |
| Molecular Formula | C27H39FO5S |
| Molecular Weight | 494.67 g/mol |
| Exact Mass | 494.25 |
| IUPAC Name | S-[[(6S,9R,16R)-9-fluoro-11-hydroxy-17-methoxy-6,10,13,16-tetramethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl]methyl] propanethioate;formaldehyde |
| SMILES | C=O.CCC(=O)SCC1(OC)[C@H](C)CC2C3C[C@H](C)C4=CC(=O)C=CC4(C)[C@@]3(F)C(O)CC21C |
| InChI | InChI=1S/C26H37FO4S.CH2O/c1-7-22(30)32-14-25(31-6)16(3)11-19-20-10-15(2)18-12-17(28)8-9-23(18,4)26(20,27)21(29)13-24(19,25)5;1-2/h8-9,12,15-16,19-21,29H,7,10-11,13-14H2,1-6H3;1H2/t15-,16+,19?,20?,21?,23?,24?,25?,26-;/m0./s1 |
| InChIKey | WJUVZZNWTXNXCH-ISVNWICHSA-N |
| XLogP | 4.72 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.67 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|