C22H30O4 — CID 87870893
(1R,2S,10S,11S,14R,15S)-14-acetyl-14-hydroxy-2,13,15-trimethyl-18-oxapentacyclo[8.8.0.01,17.02,7.011,15]octadec-7-en-5-one (PubChem CID 87870893) has the molecular formula C22H30O4 and a molecular weight of 358.48 g/mol. Its IUPAC name is (1R,2S,10S,11S,14R,15S)-14-acetyl-14-hydroxy-2,13,15-trimethyl-18-oxapentacyclo[8.8.0.01,17.02,7.011,15]octadec-7-en-5-one.
| Compound Name | (1R,2S,10S,11S,14R,15S)-14-acetyl-14-hydroxy-2,13,15-trimethyl-18-oxapentacyclo[8.8.0.01,17.02,7.011,15]octadec-7-en-5-one |
|---|---|
| PubChem CID | 87870893 |
| Molecular Formula | C22H30O4 |
| Molecular Weight | 358.48 g/mol |
| Exact Mass | 358.21 |
| IUPAC Name | (1R,2S,10S,11S,14R,15S)-14-acetyl-14-hydroxy-2,13,15-trimethyl-18-oxapentacyclo[8.8.0.01,17.02,7.011,15]octadec-7-en-5-one |
| SMILES | CC(=O)[C@@]1(O)C(C)C[C@H]2[C@@H]3CC=C4CC(=O)CC[C@]4(C)[C@]34OC4C[C@@]21C |
| InChI | InChI=1S/C22H30O4/c1-12-9-17-16-6-5-14-10-15(24)7-8-19(14,3)22(16)18(26-22)11-20(17,4)21(12,25)13(2)23/h5,12,16-18,25H,6-11H2,1-4H3/t12?,16-,17-,18?,19-,20-,21-,22-/m0/s1 |
| InChIKey | SXTFJDNQQHZCID-VDJMBIAASA-N |
| XLogP | 3.22 |
| TPSA | 66.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.48 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|