C14H20O7 — CID 10957542
(1S,2S,3S,5R,7R,8R,9R,12R)-3,7,8,12-tetrahydroxy-2,8,9-trimethyl-6,10-dioxatetracyclo[5.5.1.01,5.05,9]tridecan-11-one (PubChem CID 10957542) has the molecular formula C14H20O7 and a molecular weight of 300.31 g/mol. Its IUPAC name is (1S,2S,3S,5R,7R,8R,9R,12R)-3,7,8,12-tetrahydroxy-2,8,9-trimethyl-6,10-dioxatetracyclo[5.5.1.01,5.05,9]tridecan-11-one.
| Compound Name | (1S,2S,3S,5R,7R,8R,9R,12R)-3,7,8,12-tetrahydroxy-2,8,9-trimethyl-6,10-dioxatetracyclo[5.5.1.01,5.05,9]tridecan-11-one |
|---|---|
| PubChem CID | 10957542 |
| Molecular Formula | C14H20O7 |
| Molecular Weight | 300.31 g/mol |
| Exact Mass | 300.12 |
| IUPAC Name | (1S,2S,3S,5R,7R,8R,9R,12R)-3,7,8,12-tetrahydroxy-2,8,9-trimethyl-6,10-dioxatetracyclo[5.5.1.01,5.05,9]tridecan-11-one |
| SMILES | C[C@@H]1[C@@H](O)C[C@@]23O[C@]4(O)C[C@@]12[C@@H](O)C(=O)O[C@]3(C)[C@@]4(C)O |
| InChI | InChI=1S/C14H20O7/c1-6-7(15)4-13-11(3)10(2,18)14(19,21-13)5-12(6,13)8(16)9(17)20-11/h6-8,15-16,18-19H,4-5H2,1-3H3/t6-,7+,8+,10-,11-,12+,13+,14-/m1/s1 |
| InChIKey | YWTCYTZDWGLKDC-DKWXEOIVSA-N |
| XLogP | -1.34 |
| TPSA | 116.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.31 |
| LogP ≤ 5 | -1.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |