C16H24O5 — CID 162951159
(1R,2R,5S,7S,12S,13R,14R)-12-hydroxy-5-methoxy-2,13,14-trimethyl-4,10-dioxatetracyclo[5.3.3.12,5.01,7]tetradecan-9-one (PubChem CID 162951159) has the molecular formula C16H24O5 and a molecular weight of 296.36 g/mol. Its IUPAC name is (1R,2R,5S,7S,12S,13R,14R)-12-hydroxy-5-methoxy-2,13,14-trimethyl-4,10-dioxatetracyclo[5.3.3.12,5.01,7]tetradecan-9-one.
| Compound Name | (1R,2R,5S,7S,12S,13R,14R)-12-hydroxy-5-methoxy-2,13,14-trimethyl-4,10-dioxatetracyclo[5.3.3.12,5.01,7]tetradecan-9-one |
|---|---|
| PubChem CID | 162951159 |
| Molecular Formula | C16H24O5 |
| Molecular Weight | 296.36 g/mol |
| Exact Mass | 296.16 |
| IUPAC Name | (1R,2R,5S,7S,12S,13R,14R)-12-hydroxy-5-methoxy-2,13,14-trimethyl-4,10-dioxatetracyclo[5.3.3.12,5.01,7]tetradecan-9-one |
| SMILES | CO[C@@]12C[C@@]34CC(=O)O[C@@]3(C[C@H](O)[C@@H]4C)[C@@](C)(CO1)[C@H]2C |
| InChI | InChI=1S/C16H24O5/c1-9-11(17)5-16-13(3)8-20-15(19-4,10(13)2)7-14(9,16)6-12(18)21-16/h9-11,17H,5-8H2,1-4H3/t9-,10+,11-,13-,14+,15-,16-/m0/s1 |
| InChIKey | IWHIXZPOKSTUOA-QQRSBFTGSA-N |
| XLogP | 1.48 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.36 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |