C22H26O6 — CID 162861649
[(1R,2R,5S,7S,12S,13R,14R)-5-hydroxy-2,13,14-trimethyl-9-oxo-4,10-dioxatetracyclo[5.3.3.12,5.01,7]tetradecan-12-yl] benzoate (PubChem CID 162861649) has the molecular formula C22H26O6 and a molecular weight of 386.44 g/mol. Its IUPAC name is [(1R,2R,5S,7S,12S,13R,14R)-5-hydroxy-2,13,14-trimethyl-9-oxo-4,10-dioxatetracyclo[5.3.3.12,5.01,7]tetradecan-12-yl] benzoate.
| Compound Name | [(1R,2R,5S,7S,12S,13R,14R)-5-hydroxy-2,13,14-trimethyl-9-oxo-4,10-dioxatetracyclo[5.3.3.12,5.01,7]tetradecan-12-yl] benzoate |
|---|---|
| PubChem CID | 162861649 |
| Molecular Formula | C22H26O6 |
| Molecular Weight | 386.44 g/mol |
| Exact Mass | 386.17 |
| IUPAC Name | [(1R,2R,5S,7S,12S,13R,14R)-5-hydroxy-2,13,14-trimethyl-9-oxo-4,10-dioxatetracyclo[5.3.3.12,5.01,7]tetradecan-12-yl] benzoate |
| SMILES | C[C@@H]1[C@]2(C)CO[C@@]1(O)C[C@@]13CC(=O)O[C@]12C[C@H](OC(=O)c1ccccc1)[C@@H]3C |
| InChI | InChI=1S/C22H26O6/c1-13-16(27-18(24)15-7-5-4-6-8-15)9-22-19(3)12-26-21(25,14(19)2)11-20(13,22)10-17(23)28-22/h4-8,13-14,16,25H,9-12H2,1-3H3/t13-,14+,16-,19-,20+,21-,22-/m0/s1 |
| InChIKey | KDOWKKIVVPYLEG-RVMTVNOPSA-N |
| XLogP | 2.69 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.44 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |