C22H33NO3 — CID 21330414
[2,6-diethyl-2,3,6-trimethyl-1-(oxiran-2-ylmethyl)piperidin-4-yl] benzoate (PubChem CID 21330414) has the molecular formula C22H33NO3 and a molecular weight of 359.51 g/mol. Its IUPAC name is [2,6-diethyl-2,3,6-trimethyl-1-(oxiran-2-ylmethyl)piperidin-4-yl] benzoate.
| Compound Name | [2,6-diethyl-2,3,6-trimethyl-1-(oxiran-2-ylmethyl)piperidin-4-yl] benzoate |
|---|---|
| PubChem CID | 21330414 |
| Molecular Formula | C22H33NO3 |
| Molecular Weight | 359.51 g/mol |
| Exact Mass | 359.25 |
| IUPAC Name | [2,6-diethyl-2,3,6-trimethyl-1-(oxiran-2-ylmethyl)piperidin-4-yl] benzoate |
| SMILES | CCC1(C)CC(OC(=O)c2ccccc2)C(C)C(C)(CC)N1CC1CO1 |
| InChI | InChI=1S/C22H33NO3/c1-6-21(4)13-19(26-20(24)17-11-9-8-10-12-17)16(3)22(5,7-2)23(21)14-18-15-25-18/h8-12,16,18-19H,6-7,13-15H2,1-5H3 |
| InChIKey | CDPXKUHDVUGJMH-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 42.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.51 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|