C20H29NO3 — CID 1400019
[(4R,5S)-2,2-dimethyl-5-(piperidin-1-ylmethyl)oxan-4-yl] benzoate (PubChem CID 1400019) has the molecular formula C20H29NO3 and a molecular weight of 331.46 g/mol. Its IUPAC name is [(4R,5S)-2,2-dimethyl-5-(piperidin-1-ylmethyl)oxan-4-yl] benzoate.
| Compound Name | [(4R,5S)-2,2-dimethyl-5-(piperidin-1-ylmethyl)oxan-4-yl] benzoate |
|---|---|
| PubChem CID | 1400019 |
| Molecular Formula | C20H29NO3 |
| Molecular Weight | 331.46 g/mol |
| Exact Mass | 331.21 |
| IUPAC Name | [(4R,5S)-2,2-dimethyl-5-(piperidin-1-ylmethyl)oxan-4-yl] benzoate |
| SMILES | CC1(C)C[C@@H](OC(=O)c2ccccc2)[C@@H](CN2CCCCC2)CO1 |
| InChI | InChI=1S/C20H29NO3/c1-20(2)13-18(24-19(22)16-9-5-3-6-10-16)17(15-23-20)14-21-11-7-4-8-12-21/h3,5-6,9-10,17-18H,4,7-8,11-15H2,1-2H3/t17-,18+/m0/s1 |
| InChIKey | FULNFDKBGSTIKQ-ZWKOTPCHSA-N |
| XLogP | 3.51 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.46 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |