C20H26O6 — CID 155032698
[(3aR,7S)-4-(2-hydroxyethyl)spiro[4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-2,1'-cyclohexane]-7-yl] benzoate (PubChem CID 155032698) has the molecular formula C20H26O6 and a molecular weight of 362.42 g/mol. Its IUPAC name is [(3aR,7S)-4-(2-hydroxyethyl)spiro[4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-2,1'-cyclohexane]-7-yl] benzoate.
| Compound Name | [(3aR,7S)-4-(2-hydroxyethyl)spiro[4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-2,1'-cyclohexane]-7-yl] benzoate |
|---|---|
| PubChem CID | 155032698 |
| Molecular Formula | C20H26O6 |
| Molecular Weight | 362.42 g/mol |
| Exact Mass | 362.17 |
| IUPAC Name | [(3aR,7S)-4-(2-hydroxyethyl)spiro[4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-2,1'-cyclohexane]-7-yl] benzoate |
| SMILES | O=C(O[C@H]1COC(CCO)[C@H]2OC3(CCCCC3)OC21)c1ccccc1 |
| InChI | InChI=1S/C20H26O6/c21-12-9-15-17-18(26-20(25-17)10-5-2-6-11-20)16(13-23-15)24-19(22)14-7-3-1-4-8-14/h1,3-4,7-8,15-18,21H,2,5-6,9-13H2/t15?,16-,17+,18?/m0/s1 |
| InChIKey | PRJNUCQNCCPBRX-JDEYZFBPSA-N |
| XLogP | 2.44 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.42 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |