C18H20O6 — CID 165344826
[(3aR,5S,6S,6aR)-5-formylspiro[3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole-2,1'-cyclohexane]-6-yl] benzoate (PubChem CID 165344826) has the molecular formula C18H20O6 and a molecular weight of 332.35 g/mol. Its IUPAC name is [(3aR,5S,6S,6aR)-5-formylspiro[3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole-2,1'-cyclohexane]-6-yl] benzoate.
| Compound Name | [(3aR,5S,6S,6aR)-5-formylspiro[3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole-2,1'-cyclohexane]-6-yl] benzoate |
|---|---|
| PubChem CID | 165344826 |
| Molecular Formula | C18H20O6 |
| Molecular Weight | 332.35 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | [(3aR,5S,6S,6aR)-5-formylspiro[3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole-2,1'-cyclohexane]-6-yl] benzoate |
| SMILES | O=C[C@H]1O[C@@H]2OC3(CCCCC3)O[C@@H]2[C@H]1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C18H20O6/c19-11-13-14(22-16(20)12-7-3-1-4-8-12)15-17(21-13)24-18(23-15)9-5-2-6-10-18/h1,3-4,7-8,11,13-15,17H,2,5-6,9-10H2/t13-,14+,15-,17-/m1/s1 |
| InChIKey | NZPUFLYDQJPKDI-JYYAWHABSA-N |
| XLogP | 2.21 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.35 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|