C44H32F12O10 — CID 145437277
[(4S,6S,7R)-5,6,7-tris[[4-(trifluoromethyl)benzoyl]oxy]spiro[3a,4,5,6,7,7a-hexahydro-1,3-benzodioxole-2,1'-cyclohexane]-4-yl] 4-(trifluoromethyl)benzoate (PubChem CID 145437277) has the molecular formula C44H32F12O10 and a molecular weight of 948.71 g/mol. Its IUPAC name is [(4S,6S,7R)-5,6,7-tris[[4-(trifluoromethyl)benzoyl]oxy]spiro[3a,4,5,6,7,7a-hexahydro-1,3-benzodioxole-2,1'-cyclohexane]-4-yl] 4-(trifluoromethyl)benzoate.
| Compound Name | [(4S,6S,7R)-5,6,7-tris[[4-(trifluoromethyl)benzoyl]oxy]spiro[3a,4,5,6,7,7a-hexahydro-1,3-benzodioxole-2,1'-cyclohexane]-4-yl] 4-(trifluoromethyl)benzoate |
|---|---|
| PubChem CID | 145437277 |
| Molecular Formula | C44H32F12O10 |
| Molecular Weight | 948.71 g/mol |
| Exact Mass | 948.18 |
| IUPAC Name | [(4S,6S,7R)-5,6,7-tris[[4-(trifluoromethyl)benzoyl]oxy]spiro[3a,4,5,6,7,7a-hexahydro-1,3-benzodioxole-2,1'-cyclohexane]-4-yl] 4-(trifluoromethyl)benzoate |
| SMILES | O=C(OC1[C@@H](OC(=O)c2ccc(C(F)(F)F)cc2)C2OC3(CCCCC3)OC2[C@@H](OC(=O)c2ccc(C(F)(F)F)cc2)[C@@H]1OC(=O)c1ccc(C(F)(F)F)cc1)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C44H32F12O10/c45-41(46,47)26-12-4-22(5-13-26)36(57)61-30-31(62-37(58)23-6-14-27(15-7-23)42(48,49)50)33(64-39(60)25-10-18-29(19-11-25)44(54,55)56)35-34(65-40(66-35)20-2-1-3-21-40)32(30)63-38(59)24-8-16-28(17-9-24)43(51,52)53/h4-19,30-35H,1-3,20-21H2/t30-,31?,32+,33-,34?,35?/m1/s1 |
| InChIKey | UGYCPPOTIPNGOA-PIRXDCJYSA-N |
| XLogP | 10.42 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 948.71 |
| LogP ≤ 5 | 10.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|