C24H20F6O4 — CID 170939255
[3-[4-(trifluoromethyl)benzoyl]oxy-2-bicyclo[2.2.2]octanyl] 4-(trifluoromethyl)benzoate (PubChem CID 170939255) has the molecular formula C24H20F6O4 and a molecular weight of 486.41 g/mol. Its IUPAC name is [3-[4-(trifluoromethyl)benzoyl]oxy-2-bicyclo[2.2.2]octanyl] 4-(trifluoromethyl)benzoate.
| Compound Name | [3-[4-(trifluoromethyl)benzoyl]oxy-2-bicyclo[2.2.2]octanyl] 4-(trifluoromethyl)benzoate |
|---|---|
| PubChem CID | 170939255 |
| Molecular Formula | C24H20F6O4 |
| Molecular Weight | 486.41 g/mol |
| Exact Mass | 486.13 |
| IUPAC Name | [3-[4-(trifluoromethyl)benzoyl]oxy-2-bicyclo[2.2.2]octanyl] 4-(trifluoromethyl)benzoate |
| SMILES | O=C(OC1C2CCC(CC2)C1OC(=O)c1ccc(C(F)(F)F)cc1)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C24H20F6O4/c25-23(26,27)17-9-5-15(6-10-17)21(31)33-19-13-1-2-14(4-3-13)20(19)34-22(32)16-7-11-18(12-8-16)24(28,29)30/h5-14,19-20H,1-4H2 |
| InChIKey | KLMGXXCSKAMRCY-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.41 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |