C12H10BrF3O2 — CID 89161297
(3-bromocyclobutyl) 4-(trifluoromethyl)benzoate (PubChem CID 89161297) has the molecular formula C12H10BrF3O2 and a molecular weight of 323.11 g/mol. Its IUPAC name is (3-bromocyclobutyl) 4-(trifluoromethyl)benzoate.
| Compound Name | (3-bromocyclobutyl) 4-(trifluoromethyl)benzoate |
|---|---|
| PubChem CID | 89161297 |
| Molecular Formula | C12H10BrF3O2 |
| Molecular Weight | 323.11 g/mol |
| Exact Mass | 321.98 |
| IUPAC Name | (3-bromocyclobutyl) 4-(trifluoromethyl)benzoate |
| SMILES | O=C(OC1CC(Br)C1)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C12H10BrF3O2/c13-9-5-10(6-9)18-11(17)7-1-3-8(4-2-7)12(14,15)16/h1-4,9-10H,5-6H2 |
| InChIKey | XFXBHQHFQHLDRD-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.11 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|