C17H15F4NO2 — CID 19613099
[4-[(E)-2-cyano-2-fluoroethenyl]cyclohexyl] 4-(trifluoromethyl)benzoate (PubChem CID 19613099) has the molecular formula C17H15F4NO2 and a molecular weight of 341.30 g/mol. Its IUPAC name is [4-[(E)-2-cyano-2-fluoroethenyl]cyclohexyl] 4-(trifluoromethyl)benzoate.
| Compound Name | [4-[(E)-2-cyano-2-fluoroethenyl]cyclohexyl] 4-(trifluoromethyl)benzoate |
|---|---|
| PubChem CID | 19613099 |
| Molecular Formula | C17H15F4NO2 |
| Molecular Weight | 341.30 g/mol |
| Exact Mass | 341.10 |
| IUPAC Name | [4-[(E)-2-cyano-2-fluoroethenyl]cyclohexyl] 4-(trifluoromethyl)benzoate |
| SMILES | N#C/C(F)=C\C1CCC(OC(=O)c2ccc(C(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C17H15F4NO2/c18-14(10-22)9-11-1-7-15(8-2-11)24-16(23)12-3-5-13(6-4-12)17(19,20)21/h3-6,9,11,15H,1-2,7-8H2/b14-9+ |
| InChIKey | ZVYIPAYVGDNXCP-NTEUORMPSA-N |
| XLogP | 4.80 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.30 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|