C24H35F3O2Si — CID 123910235
[4-[1-(3-methylbutyl)silinan-4-yl]cyclohexyl] 4-(trifluoromethyl)benzoate (PubChem CID 123910235) has the molecular formula C24H35F3O2Si and a molecular weight of 440.62 g/mol. Its IUPAC name is [4-[1-(3-methylbutyl)silinan-4-yl]cyclohexyl] 4-(trifluoromethyl)benzoate.
| Compound Name | [4-[1-(3-methylbutyl)silinan-4-yl]cyclohexyl] 4-(trifluoromethyl)benzoate |
|---|---|
| PubChem CID | 123910235 |
| Molecular Formula | C24H35F3O2Si |
| Molecular Weight | 440.62 g/mol |
| Exact Mass | 440.24 |
| IUPAC Name | [4-[1-(3-methylbutyl)silinan-4-yl]cyclohexyl] 4-(trifluoromethyl)benzoate |
| SMILES | CC(C)CC[SiH]1CCC(C2CCC(OC(=O)c3ccc(C(F)(F)F)cc3)CC2)CC1 |
| InChI | InChI=1S/C24H35F3O2Si/c1-17(2)11-14-30-15-12-19(13-16-30)18-5-9-22(10-6-18)29-23(28)20-3-7-21(8-4-20)24(25,26)27/h3-4,7-8,17-19,22,30H,5-6,9-16H2,1-2H3 |
| InChIKey | QSLNNFLLWYDBIN-UHFFFAOYSA-N |
| XLogP | 7.10 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.62 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|