C22H31NO2Si — CID 123376885
[4-(1-propylsilinan-4-yl)cyclohexyl] 4-cyanobenzoate (PubChem CID 123376885) has the molecular formula C22H31NO2Si and a molecular weight of 369.58 g/mol. Its IUPAC name is [4-(1-propylsilinan-4-yl)cyclohexyl] 4-cyanobenzoate.
| Compound Name | [4-(1-propylsilinan-4-yl)cyclohexyl] 4-cyanobenzoate |
|---|---|
| PubChem CID | 123376885 |
| Molecular Formula | C22H31NO2Si |
| Molecular Weight | 369.58 g/mol |
| Exact Mass | 369.21 |
| IUPAC Name | [4-(1-propylsilinan-4-yl)cyclohexyl] 4-cyanobenzoate |
| SMILES | CCC[SiH]1CCC(C2CCC(OC(=O)c3ccc(C#N)cc3)CC2)CC1 |
| InChI | InChI=1S/C22H31NO2Si/c1-2-13-26-14-11-19(12-15-26)18-7-9-21(10-8-18)25-22(24)20-5-3-17(16-23)4-6-20/h3-6,18-19,21,26H,2,7-15H2,1H3 |
| InChIKey | KRBYYTLELXAWLI-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.58 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|