C16H18N2O4 — CID 101265205
[(1R,3S)-3-(2-nitropropan-2-yl)cyclopentyl] 4-cyanobenzoate (PubChem CID 101265205) has the molecular formula C16H18N2O4 and a molecular weight of 302.33 g/mol. Its IUPAC name is [(1R,3S)-3-(2-nitropropan-2-yl)cyclopentyl] 4-cyanobenzoate.
| Compound Name | [(1R,3S)-3-(2-nitropropan-2-yl)cyclopentyl] 4-cyanobenzoate |
|---|---|
| PubChem CID | 101265205 |
| Molecular Formula | C16H18N2O4 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | [(1R,3S)-3-(2-nitropropan-2-yl)cyclopentyl] 4-cyanobenzoate |
| SMILES | CC(C)([C@H]1CC[C@@H](OC(=O)c2ccc(C#N)cc2)C1)[N+](=O)[O-] |
| InChI | InChI=1S/C16H18N2O4/c1-16(2,18(20)21)13-7-8-14(9-13)22-15(19)12-5-3-11(10-17)4-6-12/h3-6,13-14H,7-9H2,1-2H3/t13-,14+/m0/s1 |
| InChIKey | OHHKQUXFTWANKG-UONOGXRCSA-N |
| XLogP | 2.94 |
| TPSA | 93.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|