C34H30O4 — CID 170939271
[3-(4-phenylbenzoyl)oxy-2-bicyclo[2.2.2]octanyl] 4-phenylbenzoate (PubChem CID 170939271) has the molecular formula C34H30O4 and a molecular weight of 502.61 g/mol. Its IUPAC name is [3-(4-phenylbenzoyl)oxy-2-bicyclo[2.2.2]octanyl] 4-phenylbenzoate.
| Compound Name | [3-(4-phenylbenzoyl)oxy-2-bicyclo[2.2.2]octanyl] 4-phenylbenzoate |
|---|---|
| PubChem CID | 170939271 |
| Molecular Formula | C34H30O4 |
| Molecular Weight | 502.61 g/mol |
| Exact Mass | 502.21 |
| IUPAC Name | [3-(4-phenylbenzoyl)oxy-2-bicyclo[2.2.2]octanyl] 4-phenylbenzoate |
| SMILES | O=C(OC1C2CCC(CC2)C1OC(=O)c1ccc(-c2ccccc2)cc1)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C34H30O4/c35-33(29-19-11-25(12-20-29)23-7-3-1-4-8-23)37-31-27-15-17-28(18-16-27)32(31)38-34(36)30-21-13-26(14-22-30)24-9-5-2-6-10-24/h1-14,19-22,27-28,31-32H,15-18H2 |
| InChIKey | GTAFTPVIQNJFHO-UHFFFAOYSA-N |
| XLogP | 7.59 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.61 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |