C57H42O8S — CID 118337718
[(2R,3R,4S)-3,4,5-tris[(4-phenylbenzoyl)oxy]thiolan-2-yl]methyl 4-phenylbenzoate (PubChem CID 118337718) has the molecular formula C57H42O8S and a molecular weight of 887.02 g/mol. Its IUPAC name is [(2R,3R,4S)-3,4,5-tris[(4-phenylbenzoyl)oxy]thiolan-2-yl]methyl 4-phenylbenzoate.
| Compound Name | [(2R,3R,4S)-3,4,5-tris[(4-phenylbenzoyl)oxy]thiolan-2-yl]methyl 4-phenylbenzoate |
|---|---|
| PubChem CID | 118337718 |
| Molecular Formula | C57H42O8S |
| Molecular Weight | 887.02 g/mol |
| Exact Mass | 886.26 |
| IUPAC Name | [(2R,3R,4S)-3,4,5-tris[(4-phenylbenzoyl)oxy]thiolan-2-yl]methyl 4-phenylbenzoate |
| SMILES | O=C(OC[C@H]1SC(OC(=O)c2ccc(-c3ccccc3)cc2)[C@@H](OC(=O)c2ccc(-c3ccccc3)cc2)[C@H]1OC(=O)c1ccc(-c2ccccc2)cc1)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C57H42O8S/c58-53(46-29-21-42(22-30-46)38-13-5-1-6-14-38)62-37-50-51(63-54(59)47-31-23-43(24-32-47)39-15-7-2-8-16-39)52(64-55(60)48-33-25-44(26-34-48)40-17-9-3-10-18-40)57(66-50)65-56(61)49-35-27-45(28-36-49)41-19-11-4-12-20-41/h1-36,50-52,57H,37H2/t50-,51+,52+,57?/m1/s1 |
| InChIKey | PPKIZBCXHPQYCK-XELRVENLSA-N |
| XLogP | 12.26 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 887.02 |
| LogP ≤ 5 | 12.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|