C29H28O7S — CID 118108788
[(2R,3S,4S)-5-hydroxy-3,4-bis[(4-methylbenzoyl)oxy]thiolan-2-yl]methyl 4-methylbenzoate (PubChem CID 118108788) has the molecular formula C29H28O7S and a molecular weight of 520.60 g/mol. Its IUPAC name is [(2R,3S,4S)-5-hydroxy-3,4-bis[(4-methylbenzoyl)oxy]thiolan-2-yl]methyl 4-methylbenzoate.
| Compound Name | [(2R,3S,4S)-5-hydroxy-3,4-bis[(4-methylbenzoyl)oxy]thiolan-2-yl]methyl 4-methylbenzoate |
|---|---|
| PubChem CID | 118108788 |
| Molecular Formula | C29H28O7S |
| Molecular Weight | 520.60 g/mol |
| Exact Mass | 520.16 |
| IUPAC Name | [(2R,3S,4S)-5-hydroxy-3,4-bis[(4-methylbenzoyl)oxy]thiolan-2-yl]methyl 4-methylbenzoate |
| SMILES | Cc1ccc(C(=O)OC[C@H]2SC(O)[C@@H](OC(=O)c3ccc(C)cc3)[C@@H]2OC(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C29H28O7S/c1-17-4-10-20(11-5-17)26(30)34-16-23-24(35-27(31)21-12-6-18(2)7-13-21)25(29(33)37-23)36-28(32)22-14-8-19(3)9-15-22/h4-15,23-25,29,33H,16H2,1-3H3/t23-,24-,25+,29?/m1/s1 |
| InChIKey | MFICVCCCXLVGLD-UKFIQMERSA-N |
| XLogP | 4.65 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.60 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|