About [(2R,3S,4S)-4-hydroxy-2-(hydroxymethyl)thiolan-3-yl] 4-methylbenzoate
[(2R,3S,4S)-4-hydroxy-2-(hydroxymethyl)thiolan-3-yl] 4-methylbenzoate (PubChem CID 140763234) has the molecular formula C13H16O4S
and a molecular weight of 268.33 g/mol. Its IUPAC name is [(2R,3S,4S)-4-hydroxy-2-(hydroxymethyl)thiolan-3-yl] 4-methylbenzoate.
Molecular Properties
| Compound Name | [(2R,3S,4S)-4-hydroxy-2-(hydroxymethyl)thiolan-3-yl] 4-methylbenzoate |
| PubChem CID | 140763234 |
| Molecular Formula | C13H16O4S |
| Molecular Weight | 268.33 g/mol |
| Exact Mass | 268.08 |
| IUPAC Name | [(2R,3S,4S)-4-hydroxy-2-(hydroxymethyl)thiolan-3-yl] 4-methylbenzoate |
| SMILES | Cc1ccc(C(=O)O[C@H]2[C@H](O)CS[C@@H]2CO)cc1 |
| InChI | InChI=1S/C13H16O4S/c1-8-2-4-9(5-3-8)13(16)17-12-10(15)7-18-11(12)6-14/h2-5,10-12,14-15H,6-7H2,1H3/t10-,11-,12+/m1/s1 |
| InChIKey | ZEZSZVNUFYKCOC-UTUOFQBUSA-N |
| XLogP | 0.99 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.33 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [(2R,3S,4S)-4-hydroxy-2-(hydroxymethyl)thiolan-3-yl] 4-methylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R,3S,4S)-4-hydroxy-2-(hydroxymethyl)thiolan-3-yl] 4-methylbenzoate?
The IUPAC name of [(2R,3S,4S)-4-hydroxy-2-(hydroxymethyl)thiolan-3-yl] 4-methylbenzoate (CID 140763234) is [(2R,3S,4S)-4-hydroxy-2-(hydroxymethyl)thiolan-3-yl] 4-methylbenzoate.
What is the SMILES notation for [(2R,3S,4S)-4-hydroxy-2-(hydroxymethyl)thiolan-3-yl] 4-methylbenzoate?
The canonical SMILES for [(2R,3S,4S)-4-hydroxy-2-(hydroxymethyl)thiolan-3-yl] 4-methylbenzoate is Cc1ccc(C(=O)O[C@H]2[C@H](O)CS[C@@H]2CO)cc1.
What is the InChIKey of [(2R,3S,4S)-4-hydroxy-2-(hydroxymethyl)thiolan-3-yl] 4-methylbenzoate?
The InChIKey is ZEZSZVNUFYKCOC-UTUOFQBUSA-N. The full InChI is InChI=1S/C13H16O4S/c1-8-2-4-9(5-3-8)13(16)17-12-10(15)7-18-11(12)6-14/h2-5,10-12,14-15H,6-7H2,1H3/t10-,11-,12+/m1/s1.
What are the key properties of [(2R,3S,4S)-4-hydroxy-2-(hydroxymethyl)thiolan-3-yl] 4-methylbenzoate?
[(2R,3S,4S)-4-hydroxy-2-(hydroxymethyl)thiolan-3-yl] 4-methylbenzoate has a molecular weight of 268.33 g/mol, XLogP of 0.99, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R,3S,4S)-4-hydroxy-2-(hydroxymethyl)thiolan-3-yl] 4-methylbenzoate is sourced from PubChem (CID 140763234), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).