C27H24O8S — CID 144905734
(3-benzoyloxy-5-hydroxy-4-phenylmethoxycarbonyloxythiolan-2-yl)methyl benzoate (PubChem CID 144905734) has the molecular formula C27H24O8S and a molecular weight of 508.55 g/mol. Its IUPAC name is (3-benzoyloxy-5-hydroxy-4-phenylmethoxycarbonyloxythiolan-2-yl)methyl benzoate.
| Compound Name | (3-benzoyloxy-5-hydroxy-4-phenylmethoxycarbonyloxythiolan-2-yl)methyl benzoate |
|---|---|
| PubChem CID | 144905734 |
| Molecular Formula | C27H24O8S |
| Molecular Weight | 508.55 g/mol |
| Exact Mass | 508.12 |
| IUPAC Name | (3-benzoyloxy-5-hydroxy-4-phenylmethoxycarbonyloxythiolan-2-yl)methyl benzoate |
| SMILES | O=C(OCc1ccccc1)OC1C(O)SC(COC(=O)c2ccccc2)C1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C27H24O8S/c28-24(19-12-6-2-7-13-19)32-17-21-22(34-25(29)20-14-8-3-9-15-20)23(26(30)36-21)35-27(31)33-16-18-10-4-1-5-11-18/h1-15,21-23,26,30H,16-17H2 |
| InChIKey | BYQHYMHPSXCRRD-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.55 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|