C32H27NO7S — CID 134233256
[(3S,4R,5R)-2,4-dibenzoyloxy-3-phenylmethoxy-1,2-thiazolidin-5-yl]methyl benzoate (PubChem CID 134233256) has the molecular formula C32H27NO7S and a molecular weight of 569.64 g/mol. Its IUPAC name is [(3S,4R,5R)-2,4-dibenzoyloxy-3-phenylmethoxy-1,2-thiazolidin-5-yl]methyl benzoate.
| Compound Name | [(3S,4R,5R)-2,4-dibenzoyloxy-3-phenylmethoxy-1,2-thiazolidin-5-yl]methyl benzoate |
|---|---|
| PubChem CID | 134233256 |
| Molecular Formula | C32H27NO7S |
| Molecular Weight | 569.64 g/mol |
| Exact Mass | 569.15 |
| IUPAC Name | [(3S,4R,5R)-2,4-dibenzoyloxy-3-phenylmethoxy-1,2-thiazolidin-5-yl]methyl benzoate |
| SMILES | O=C(OC[C@H]1SN(OC(=O)c2ccccc2)[C@@H](OCc2ccccc2)[C@H]1OC(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C32H27NO7S/c34-30(24-15-7-2-8-16-24)38-22-27-28(39-31(35)25-17-9-3-10-18-25)29(37-21-23-13-5-1-6-14-23)33(41-27)40-32(36)26-19-11-4-12-20-26/h1-20,27-29H,21-22H2/t27-,28+,29+/m1/s1 |
| InChIKey | VMECSFKTHHVIJI-ULNSLHSMSA-N |
| XLogP | 5.72 |
| TPSA | 91.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.64 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|