C14H14BrFO6S — CID 118108762
benzyl [(2R,3S,4S)-5-bromo-2-(carboxyoxymethyl)-4-fluorothiolan-3-yl] carbonate (PubChem CID 118108762) has the molecular formula C14H14BrFO6S and a molecular weight of 409.23 g/mol. Its IUPAC name is benzyl [(2R,3S,4S)-5-bromo-2-(carboxyoxymethyl)-4-fluorothiolan-3-yl] carbonate.
| Compound Name | benzyl [(2R,3S,4S)-5-bromo-2-(carboxyoxymethyl)-4-fluorothiolan-3-yl] carbonate |
|---|---|
| PubChem CID | 118108762 |
| Molecular Formula | C14H14BrFO6S |
| Molecular Weight | 409.23 g/mol |
| Exact Mass | 407.97 |
| IUPAC Name | benzyl [(2R,3S,4S)-5-bromo-2-(carboxyoxymethyl)-4-fluorothiolan-3-yl] carbonate |
| SMILES | O=C(O)OC[C@H]1SC(Br)[C@@H](F)[C@@H]1OC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C14H14BrFO6S/c15-12-10(16)11(9(23-12)7-20-13(17)18)22-14(19)21-6-8-4-2-1-3-5-8/h1-5,9-12H,6-7H2,(H,17,18)/t9-,10+,11-,12?/m1/s1 |
| InChIKey | CIJCAGJVOIHTKI-FBTJUVTCSA-N |
| XLogP | 3.58 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.23 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|