C20H20O4S — CID 118338063
[(2S)-5-acetyloxythiolan-2-yl]methyl 4-phenylbenzoate (PubChem CID 118338063) has the molecular formula C20H20O4S and a molecular weight of 356.44 g/mol. Its IUPAC name is [(2S)-5-acetyloxythiolan-2-yl]methyl 4-phenylbenzoate.
| Compound Name | [(2S)-5-acetyloxythiolan-2-yl]methyl 4-phenylbenzoate |
|---|---|
| PubChem CID | 118338063 |
| Molecular Formula | C20H20O4S |
| Molecular Weight | 356.44 g/mol |
| Exact Mass | 356.11 |
| IUPAC Name | [(2S)-5-acetyloxythiolan-2-yl]methyl 4-phenylbenzoate |
| SMILES | CC(=O)OC1CC[C@@H](COC(=O)c2ccc(-c3ccccc3)cc2)S1 |
| InChI | InChI=1S/C20H20O4S/c1-14(21)24-19-12-11-18(25-19)13-23-20(22)17-9-7-16(8-10-17)15-5-3-2-4-6-15/h2-10,18-19H,11-13H2,1H3/t18-,19?/m0/s1 |
| InChIKey | ACMBHAAFARFNHR-OYKVQYDMSA-N |
| XLogP | 4.30 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.44 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |