C20H19FO5 — CID 101236200
[(2R,3S,5R)-5-acetyloxy-3-fluorooxolan-2-yl]methyl 4-phenylbenzoate (PubChem CID 101236200) has the molecular formula C20H19FO5 and a molecular weight of 358.37 g/mol. Its IUPAC name is [(2R,3S,5R)-5-acetyloxy-3-fluorooxolan-2-yl]methyl 4-phenylbenzoate.
| Compound Name | [(2R,3S,5R)-5-acetyloxy-3-fluorooxolan-2-yl]methyl 4-phenylbenzoate |
|---|---|
| PubChem CID | 101236200 |
| Molecular Formula | C20H19FO5 |
| Molecular Weight | 358.37 g/mol |
| Exact Mass | 358.12 |
| IUPAC Name | [(2R,3S,5R)-5-acetyloxy-3-fluorooxolan-2-yl]methyl 4-phenylbenzoate |
| SMILES | CC(=O)O[C@@H]1C[C@H](F)[C@@H](COC(=O)c2ccc(-c3ccccc3)cc2)O1 |
| InChI | InChI=1S/C20H19FO5/c1-13(22)25-19-11-17(21)18(26-19)12-24-20(23)16-9-7-15(8-10-16)14-5-3-2-4-6-14/h2-10,17-19H,11-12H2,1H3/t17-,18+,19-/m0/s1 |
| InChIKey | JNNFSFSMHMLSHS-OTWHNJEPSA-N |
| XLogP | 3.53 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.37 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |