C16H22FO6P — CID 11142915
[(2R,3S,5R)-5-diethoxyphosphanyloxy-3-fluorooxolan-2-yl]methyl benzoate (PubChem CID 11142915) has the molecular formula C16H22FO6P and a molecular weight of 360.32 g/mol. Its IUPAC name is [(2R,3S,5R)-5-diethoxyphosphanyloxy-3-fluorooxolan-2-yl]methyl benzoate.
| Compound Name | [(2R,3S,5R)-5-diethoxyphosphanyloxy-3-fluorooxolan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 11142915 |
| Molecular Formula | C16H22FO6P |
| Molecular Weight | 360.32 g/mol |
| Exact Mass | 360.11 |
| IUPAC Name | [(2R,3S,5R)-5-diethoxyphosphanyloxy-3-fluorooxolan-2-yl]methyl benzoate |
| SMILES | CCOP(OCC)O[C@@H]1C[C@H](F)[C@@H](COC(=O)c2ccccc2)O1 |
| InChI | InChI=1S/C16H22FO6P/c1-3-20-24(21-4-2)23-15-10-13(17)14(22-15)11-19-16(18)12-8-6-5-7-9-12/h5-9,13-15H,3-4,10-11H2,1-2H3/t13-,14+,15+/m0/s1 |
| InChIKey | FAQCLYQSONMTQL-RRFJBIMHSA-N |
| XLogP | 3.61 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.32 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|