C31H27FO5S — CID 144573268
(4-fluoro-5-hydroxythiolan-2-yl)methyl 4-phenylbenzoate;4-phenylbenzoic acid (PubChem CID 144573268) has the molecular formula C31H27FO5S and a molecular weight of 530.62 g/mol. Its IUPAC name is (4-fluoro-5-hydroxythiolan-2-yl)methyl 4-phenylbenzoate;4-phenylbenzoic acid.
| Compound Name | (4-fluoro-5-hydroxythiolan-2-yl)methyl 4-phenylbenzoate;4-phenylbenzoic acid |
|---|---|
| PubChem CID | 144573268 |
| Molecular Formula | C31H27FO5S |
| Molecular Weight | 530.62 g/mol |
| Exact Mass | 530.16 |
| IUPAC Name | (4-fluoro-5-hydroxythiolan-2-yl)methyl 4-phenylbenzoate;4-phenylbenzoic acid |
| SMILES | O=C(O)c1ccc(-c2ccccc2)cc1.O=C(OCC1CC(F)C(O)S1)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C18H17FO3S.C13H10O2/c19-16-10-15(23-18(16)21)11-22-17(20)14-8-6-13(7-9-14)12-4-2-1-3-5-12;14-13(15)12-8-6-11(7-9-12)10-4-2-1-3-5-10/h1-9,15-16,18,21H,10-11H2;1-9H,(H,14,15) |
| InChIKey | ZRAORONXVNSLIX-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.62 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |