C14H17FO3S — CID 144573128
(4-fluoro-5-hydroxythiolan-2-yl)methyl 3,5-dimethylbenzoate (PubChem CID 144573128) has the molecular formula C14H17FO3S and a molecular weight of 284.35 g/mol. Its IUPAC name is (4-fluoro-5-hydroxythiolan-2-yl)methyl 3,5-dimethylbenzoate.
| Compound Name | (4-fluoro-5-hydroxythiolan-2-yl)methyl 3,5-dimethylbenzoate |
|---|---|
| PubChem CID | 144573128 |
| Molecular Formula | C14H17FO3S |
| Molecular Weight | 284.35 g/mol |
| Exact Mass | 284.09 |
| IUPAC Name | (4-fluoro-5-hydroxythiolan-2-yl)methyl 3,5-dimethylbenzoate |
| SMILES | Cc1cc(C)cc(C(=O)OCC2CC(F)C(O)S2)c1 |
| InChI | InChI=1S/C14H17FO3S/c1-8-3-9(2)5-10(4-8)13(16)18-7-11-6-12(15)14(17)19-11/h3-5,11-12,14,17H,6-7H2,1-2H3 |
| InChIKey | ZURCNSKBEOTVFP-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.35 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |