C31H26O4S — CID 144905437
[(2R)-3-(4-phenylbenzoyl)oxythiolan-2-yl]methyl 4-phenylbenzoate (PubChem CID 144905437) has the molecular formula C31H26O4S and a molecular weight of 494.61 g/mol. Its IUPAC name is [(2R)-3-(4-phenylbenzoyl)oxythiolan-2-yl]methyl 4-phenylbenzoate.
| Compound Name | [(2R)-3-(4-phenylbenzoyl)oxythiolan-2-yl]methyl 4-phenylbenzoate |
|---|---|
| PubChem CID | 144905437 |
| Molecular Formula | C31H26O4S |
| Molecular Weight | 494.61 g/mol |
| Exact Mass | 494.16 |
| IUPAC Name | [(2R)-3-(4-phenylbenzoyl)oxythiolan-2-yl]methyl 4-phenylbenzoate |
| SMILES | O=C(OC[C@H]1SCCC1OC(=O)c1ccc(-c2ccccc2)cc1)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C31H26O4S/c32-30(26-15-11-24(12-16-26)22-7-3-1-4-8-22)34-21-29-28(19-20-36-29)35-31(33)27-17-13-25(14-18-27)23-9-5-2-6-10-23/h1-18,28-29H,19-21H2/t28?,29-/m1/s1 |
| InChIKey | IOTPAWAWLAHKPC-YPJJGMIRSA-N |
| XLogP | 6.91 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.61 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |