C30H34O6S — CID 144905528
benzyl hydrogen carbonate;ethane;[(3R)-2-(1-phenylethenoxymethyl)thiolan-3-yl] benzoate (PubChem CID 144905528) has the molecular formula C30H34O6S and a molecular weight of 522.66 g/mol. Its IUPAC name is benzyl hydrogen carbonate;ethane;[(3R)-2-(1-phenylethenoxymethyl)thiolan-3-yl] benzoate.
| Compound Name | benzyl hydrogen carbonate;ethane;[(3R)-2-(1-phenylethenoxymethyl)thiolan-3-yl] benzoate |
|---|---|
| PubChem CID | 144905528 |
| Molecular Formula | C30H34O6S |
| Molecular Weight | 522.66 g/mol |
| Exact Mass | 522.21 |
| IUPAC Name | benzyl hydrogen carbonate;ethane;[(3R)-2-(1-phenylethenoxymethyl)thiolan-3-yl] benzoate |
| SMILES | C=C(OCC1SCC[C@H]1OC(=O)c1ccccc1)c1ccccc1.CC.O=C(O)OCc1ccccc1 |
| InChI | InChI=1S/C20H20O3S.C8H8O3.C2H6/c1-15(16-8-4-2-5-9-16)22-14-19-18(12-13-24-19)23-20(21)17-10-6-3-7-11-17;9-8(10)11-6-7-4-2-1-3-5-7;1-2/h2-11,18-19H,1,12-14H2;1-5H,6H2,(H,9,10);1-2H3/t18-,19?;;/m1../s1 |
| InChIKey | GYKOETMMULODER-HQDRINPVSA-N |
| XLogP | 7.31 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.66 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|