C25H26O5S — CID 144905462
[(2R,3R)-3-benzoyloxy-5-[(3E)-3-methylpenta-1,3-dien-2-yl]oxythiolan-2-yl]methyl benzoate (PubChem CID 144905462) has the molecular formula C25H26O5S and a molecular weight of 438.55 g/mol. Its IUPAC name is [(2R,3R)-3-benzoyloxy-5-[(3E)-3-methylpenta-1,3-dien-2-yl]oxythiolan-2-yl]methyl benzoate.
| Compound Name | [(2R,3R)-3-benzoyloxy-5-[(3E)-3-methylpenta-1,3-dien-2-yl]oxythiolan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 144905462 |
| Molecular Formula | C25H26O5S |
| Molecular Weight | 438.55 g/mol |
| Exact Mass | 438.15 |
| IUPAC Name | [(2R,3R)-3-benzoyloxy-5-[(3E)-3-methylpenta-1,3-dien-2-yl]oxythiolan-2-yl]methyl benzoate |
| SMILES | C=C(OC1C[C@@H](OC(=O)c2ccccc2)[C@@H](COC(=O)c2ccccc2)S1)/C(C)=C/C |
| InChI | InChI=1S/C25H26O5S/c1-4-17(2)18(3)29-23-15-21(30-25(27)20-13-9-6-10-14-20)22(31-23)16-28-24(26)19-11-7-5-8-12-19/h4-14,21-23H,3,15-16H2,1-2H3/b17-4+/t21-,22-,23?/m1/s1 |
| InChIKey | WQTBAGNZRARXRK-FWVNUMEQSA-N |
| XLogP | 5.40 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.55 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|