C20H19NO5S — CID 10385399
[(2R,5S)-3-acetyl-5-benzoyloxy-1,3-thiazolidin-2-yl]methyl benzoate (PubChem CID 10385399) has the molecular formula C20H19NO5S and a molecular weight of 385.44 g/mol. Its IUPAC name is [(2R,5S)-3-acetyl-5-benzoyloxy-1,3-thiazolidin-2-yl]methyl benzoate.
| Compound Name | [(2R,5S)-3-acetyl-5-benzoyloxy-1,3-thiazolidin-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 10385399 |
| Molecular Formula | C20H19NO5S |
| Molecular Weight | 385.44 g/mol |
| Exact Mass | 385.10 |
| IUPAC Name | [(2R,5S)-3-acetyl-5-benzoyloxy-1,3-thiazolidin-2-yl]methyl benzoate |
| SMILES | CC(=O)N1C[C@@H](OC(=O)c2ccccc2)S[C@@H]1COC(=O)c1ccccc1 |
| InChI | InChI=1S/C20H19NO5S/c1-14(22)21-12-18(26-20(24)16-10-6-3-7-11-16)27-17(21)13-25-19(23)15-8-4-2-5-9-15/h2-11,17-18H,12-13H2,1H3/t17-,18+/m1/s1 |
| InChIKey | ZRMGIQMAFLFIPB-MSOLQXFVSA-N |
| XLogP | 2.95 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.44 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |