C13H13NO4S — CID 121004136
(3-acetyl-4-oxo-1,3-thiazolidin-2-yl)methyl benzoate (PubChem CID 121004136) has the molecular formula C13H13NO4S and a molecular weight of 279.32 g/mol. Its IUPAC name is (3-acetyl-4-oxo-1,3-thiazolidin-2-yl)methyl benzoate.
| Compound Name | (3-acetyl-4-oxo-1,3-thiazolidin-2-yl)methyl benzoate |
|---|---|
| PubChem CID | 121004136 |
| Molecular Formula | C13H13NO4S |
| Molecular Weight | 279.32 g/mol |
| Exact Mass | 279.06 |
| IUPAC Name | (3-acetyl-4-oxo-1,3-thiazolidin-2-yl)methyl benzoate |
| SMILES | CC(=O)N1C(=O)CSC1COC(=O)c1ccccc1 |
| InChI | InChI=1S/C13H13NO4S/c1-9(15)14-11(16)8-19-12(14)7-18-13(17)10-5-3-2-4-6-10/h2-6,12H,7-8H2,1H3 |
| InChIKey | APEKBTBDEUDOFD-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.32 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |