C44H36O6S — CID 134233259
[(2S,3R,4R)-3-(4-phenylbenzoyl)oxy-4-(4-phenylcyclohexa-2,4-diene-1-carbonyl)oxythiolan-2-yl]methyl 4-phenylbenzoate (PubChem CID 134233259) has the molecular formula C44H36O6S and a molecular weight of 692.83 g/mol. Its IUPAC name is [(2S,3R,4R)-3-(4-phenylbenzoyl)oxy-4-(4-phenylcyclohexa-2,4-diene-1-carbonyl)oxythiolan-2-yl]methyl 4-phenylbenzoate.
| Compound Name | [(2S,3R,4R)-3-(4-phenylbenzoyl)oxy-4-(4-phenylcyclohexa-2,4-diene-1-carbonyl)oxythiolan-2-yl]methyl 4-phenylbenzoate |
|---|---|
| PubChem CID | 134233259 |
| Molecular Formula | C44H36O6S |
| Molecular Weight | 692.83 g/mol |
| Exact Mass | 692.22 |
| IUPAC Name | [(2S,3R,4R)-3-(4-phenylbenzoyl)oxy-4-(4-phenylcyclohexa-2,4-diene-1-carbonyl)oxythiolan-2-yl]methyl 4-phenylbenzoate |
| SMILES | O=C(OC[C@@H]1SC[C@H](OC(=O)C2C=CC(c3ccccc3)=CC2)[C@H]1OC(=O)c1ccc(-c2ccccc2)cc1)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C44H36O6S/c45-42(36-22-16-33(17-23-36)30-10-4-1-5-11-30)48-28-40-41(50-44(47)38-26-20-35(21-27-38)32-14-8-3-9-15-32)39(29-51-40)49-43(46)37-24-18-34(19-25-37)31-12-6-2-7-13-31/h1-24,26-27,37,39-41H,25,28-29H2/t37?,39-,40-,41+/m0/s1 |
| InChIKey | YQOSZNAAQFGPCD-DCKIBFITSA-N |
| XLogP | 9.09 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.83 |
| LogP ≤ 5 | 9.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|