C26H17F3O4 — CID 102250826
cyclopenta-2,4-dien-1-yl 4-[4-[4-(trifluoromethyl)benzoyl]oxyphenyl]benzoate (PubChem CID 102250826) has the molecular formula C26H17F3O4 and a molecular weight of 450.41 g/mol. Its IUPAC name is cyclopenta-2,4-dien-1-yl 4-[4-[4-(trifluoromethyl)benzoyl]oxyphenyl]benzoate.
| Compound Name | cyclopenta-2,4-dien-1-yl 4-[4-[4-(trifluoromethyl)benzoyl]oxyphenyl]benzoate |
|---|---|
| PubChem CID | 102250826 |
| Molecular Formula | C26H17F3O4 |
| Molecular Weight | 450.41 g/mol |
| Exact Mass | 450.11 |
| IUPAC Name | cyclopenta-2,4-dien-1-yl 4-[4-[4-(trifluoromethyl)benzoyl]oxyphenyl]benzoate |
| SMILES | O=C(Oc1ccc(-c2ccc(C(=O)OC3C=CC=C3)cc2)cc1)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C26H17F3O4/c27-26(28,29)21-13-9-20(10-14-21)25(31)33-23-15-11-18(12-16-23)17-5-7-19(8-6-17)24(30)32-22-3-1-2-4-22/h1-16,22H |
| InChIKey | IVJUCGOZJVQRPH-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.41 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|