C23H30O7 — CID 118056742
[(3aR,4S,6S)-4-[(1R)-1,2-dihydroxyethyl]-6-prop-2-enylspiro[4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-2,1'-cyclohexane]-7-yl] benzoate (PubChem CID 118056742) has the molecular formula C23H30O7 and a molecular weight of 418.49 g/mol. Its IUPAC name is [(3aR,4S,6S)-4-[(1R)-1,2-dihydroxyethyl]-6-prop-2-enylspiro[4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-2,1'-cyclohexane]-7-yl] benzoate.
| Compound Name | [(3aR,4S,6S)-4-[(1R)-1,2-dihydroxyethyl]-6-prop-2-enylspiro[4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-2,1'-cyclohexane]-7-yl] benzoate |
|---|---|
| PubChem CID | 118056742 |
| Molecular Formula | C23H30O7 |
| Molecular Weight | 418.49 g/mol |
| Exact Mass | 418.20 |
| IUPAC Name | [(3aR,4S,6S)-4-[(1R)-1,2-dihydroxyethyl]-6-prop-2-enylspiro[4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-2,1'-cyclohexane]-7-yl] benzoate |
| SMILES | C=CC[C@@H]1O[C@@H]([C@H](O)CO)[C@H]2OC3(CCCCC3)OC2C1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C23H30O7/c1-2-9-17-19(28-22(26)15-10-5-3-6-11-15)21-20(18(27-17)16(25)14-24)29-23(30-21)12-7-4-8-13-23/h2-3,5-6,10-11,16-21,24-25H,1,4,7-9,12-14H2/t16-,17+,18+,19?,20-,21?/m1/s1 |
| InChIKey | HZSRGXIKHHVREY-QRUHNYRSSA-N |
| XLogP | 2.35 |
| TPSA | 94.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.49 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|