C24H31NO2 — CID 21330442
(6-ethyl-1,2,3,6-tetramethyl-2-phenylpiperidin-4-yl) benzoate (PubChem CID 21330442) has the molecular formula C24H31NO2 and a molecular weight of 365.52 g/mol. Its IUPAC name is (6-ethyl-1,2,3,6-tetramethyl-2-phenylpiperidin-4-yl) benzoate.
| Compound Name | (6-ethyl-1,2,3,6-tetramethyl-2-phenylpiperidin-4-yl) benzoate |
|---|---|
| PubChem CID | 21330442 |
| Molecular Formula | C24H31NO2 |
| Molecular Weight | 365.52 g/mol |
| Exact Mass | 365.24 |
| IUPAC Name | (6-ethyl-1,2,3,6-tetramethyl-2-phenylpiperidin-4-yl) benzoate |
| SMILES | CCC1(C)CC(OC(=O)c2ccccc2)C(C)C(C)(c2ccccc2)N1C |
| InChI | InChI=1S/C24H31NO2/c1-6-23(3)17-21(27-22(26)19-13-9-7-10-14-19)18(2)24(4,25(23)5)20-15-11-8-12-16-20/h7-16,18,21H,6,17H2,1-5H3 |
| InChIKey | YEFXVQDZDPVIGX-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.52 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |