C43H66N2O4 — CID 18358563
dibenzyl 2,2-bis(2,6-diethyl-1,2,3,6-tetramethylpiperidin-4-yl)propanedioate (PubChem CID 18358563) has the molecular formula C43H66N2O4 and a molecular weight of 675.01 g/mol. Its IUPAC name is dibenzyl 2,2-bis(2,6-diethyl-1,2,3,6-tetramethylpiperidin-4-yl)propanedioate.
| Compound Name | dibenzyl 2,2-bis(2,6-diethyl-1,2,3,6-tetramethylpiperidin-4-yl)propanedioate |
|---|---|
| PubChem CID | 18358563 |
| Molecular Formula | C43H66N2O4 |
| Molecular Weight | 675.01 g/mol |
| Exact Mass | 674.50 |
| IUPAC Name | dibenzyl 2,2-bis(2,6-diethyl-1,2,3,6-tetramethylpiperidin-4-yl)propanedioate |
| SMILES | CCC1(C)CC(C(C(=O)OCc2ccccc2)(C(=O)OCc2ccccc2)C2CC(C)(CC)N(C)C(C)(CC)C2C)C(C)C(C)(CC)N1C |
| InChI | InChI=1S/C43H66N2O4/c1-13-39(7)27-35(31(5)41(9,15-3)44(39)11)43(37(46)48-29-33-23-19-17-20-24-33,38(47)49-30-34-25-21-18-22-26-34)36-28-40(8,14-2)45(12)42(10,16-4)32(36)6/h17-26,31-32,35-36H,13-16,27-30H2,1-12H3 |
| InChIKey | UWXAVEWZVXIZTQ-UHFFFAOYSA-N |
| XLogP | 9.31 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.01 |
| LogP ≤ 5 | 9.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|