C18H25ClO3 — CID 10544011
benzyl (1R,2R,3S,5R)-5-(2-chloropropan-2-yl)-3-hydroxy-2,3-dimethylcyclopentane-1-carboxylate (PubChem CID 10544011) has the molecular formula C18H25ClO3 and a molecular weight of 324.85 g/mol. Its IUPAC name is benzyl (1R,2R,3S,5R)-5-(2-chloropropan-2-yl)-3-hydroxy-2,3-dimethylcyclopentane-1-carboxylate.
| Compound Name | benzyl (1R,2R,3S,5R)-5-(2-chloropropan-2-yl)-3-hydroxy-2,3-dimethylcyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 10544011 |
| Molecular Formula | C18H25ClO3 |
| Molecular Weight | 324.85 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | benzyl (1R,2R,3S,5R)-5-(2-chloropropan-2-yl)-3-hydroxy-2,3-dimethylcyclopentane-1-carboxylate |
| SMILES | C[C@@H]1[C@@H](C(=O)OCc2ccccc2)[C@H](C(C)(C)Cl)C[C@]1(C)O |
| InChI | InChI=1S/C18H25ClO3/c1-12-15(14(17(2,3)19)10-18(12,4)21)16(20)22-11-13-8-6-5-7-9-13/h5-9,12,14-15,21H,10-11H2,1-4H3/t12-,14-,15-,18+/m1/s1 |
| InChIKey | VKKNFVOQXVABSP-DRRHNWJESA-N |
| XLogP | 3.77 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.85 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|