C49H78N2O5 — CID 89252886
1-O-(2,6-diethyl-1,2,3,6-tetramethylpiperidin-4-yl) 3-O-(2,6-diethyl-1,2,6-trimethylpiperidin-4-yl) 2-[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]-2-phenylpropanedioate (PubChem CID 89252886) has the molecular formula C49H78N2O5 and a molecular weight of 775.17 g/mol. Its IUPAC name is 1-O-(2,6-diethyl-1,2,3,6-tetramethylpiperidin-4-yl) 3-O-(2,6-diethyl-1,2,6-trimethylpiperidin-4-yl) 2-[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]-2-phenylpropanedioate.
| Compound Name | 1-O-(2,6-diethyl-1,2,3,6-tetramethylpiperidin-4-yl) 3-O-(2,6-diethyl-1,2,6-trimethylpiperidin-4-yl) 2-[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]-2-phenylpropanedioate |
|---|---|
| PubChem CID | 89252886 |
| Molecular Formula | C49H78N2O5 |
| Molecular Weight | 775.17 g/mol |
| Exact Mass | 774.59 |
| IUPAC Name | 1-O-(2,6-diethyl-1,2,3,6-tetramethylpiperidin-4-yl) 3-O-(2,6-diethyl-1,2,6-trimethylpiperidin-4-yl) 2-[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]-2-phenylpropanedioate |
| SMILES | CCC1(C)CC(OC(=O)C(Cc2cc(C(C)(C)C)c(O)c(C(C)(C)C)c2)(C(=O)OC2CC(C)(CC)N(C)C(C)(CC)C2C)c2ccccc2)CC(C)(CC)N1C |
| InChI | InChI=1S/C49H78N2O5/c1-18-45(12)30-36(31-46(13,19-2)50(45)16)55-41(53)49(35-25-23-22-24-26-35,29-34-27-37(43(6,7)8)40(52)38(28-34)44(9,10)11)42(54)56-39-32-47(14,20-3)51(17)48(15,21-4)33(39)5/h22-28,33,36,39,52H,18-21,29-32H2,1-17H3 |
| InChIKey | HTQZYIOVZBZRQJ-UHFFFAOYSA-N |
| XLogP | 10.66 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 775.17 |
| LogP ≤ 5 | 10.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|